| MDL | - |
|---|---|
| Molecular Weight | 587.75 |
| Molecular Formula | C34H45N5O4 |
| SMILES | CN[C@H](C(N[C@@H]1C(N(C2=C(N([C@H]1C)C(CCCCCCCN)=O)C=CC=C2)CC3=C(C=CC=C4)C4=CC=C3OC)=O)=O)C |
XIAP degrader-1, a primary amine tethered small molecule, promotes the degradation of X-linked inhibitor of apoptosis protein (XIAP) .
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 100 mg/mL ( 170.14 mM ; Need ultrasonic)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 1.7014 mL | 8.5070 mL | 17.0140 mL |
| 5 mM | 0.3403 mL | 1.7014 mL | 3.4028 mL |
| 10 mM | 0.1701 mL | 0.8507 mL | 1.7014 mL |