| MDL | MFCD28015902 |
|---|---|
| Molecular Weight | 402.48 |
| Molecular Formula | C23H30O6 |
| SMILES | CC(/C=C/C=C/C=C/C(O1)=C(C(OC)=CC1=O)C)=C\[C@]2([C@H](O)[C@]([C@H](O2)C)(O)C)C |
Citreoviridin, a toxin from Penicillium citreoviride NRRL 2579, inhibits brain synaptosomal Na + /K + -ATPase whereas in microsomes, both Na + /K + -ATPase and Mg 2+ -ATPase activities are significantly stimulated in a dose-dependent manner [1] . Citreoviridin inhibits cell proliferation and enhances apoptosis of human umbilical vein endothelial cells [2] .
Solid
Penicillium citreoviride
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |