| MDL | - |
|---|---|
| Molecular Weight | 468.71 |
| Molecular Formula | C31H48O3 |
| SMILES | CC1(C)C(CC[C@]2(C)[C@@]3([H])CC=C4[C@]5([H])CC(C)(C)CC[C@@](C(OC)=O)5CC[C@](C)4[C@@](C)3CC[C@@]12[H])=O |
Methyl oleanonate is a natural triterpene PPARγ agonist isolated from the species of Pistacia lentiscus var. Chia [1] . Methyl oleanonate is a modified oleanolic acid derivative with anti-cancer effects [2] .
|
PPARγ |
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 2.5 mg/mL ( 5.33 mM ; ultrasonic and warming and heat to 60°C)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.1335 mL | 10.6676 mL | 21.3352 mL |
| 5 mM | 0.4267 mL | 2.1335 mL | 4.2670 mL |
| 10 mM | --- | --- | --- |