| MDL | MFCD20526610 |
|---|---|
| Molecular Weight | 417.39 |
| Molecular Formula | C19H15NO8S |
| SMILES | O=S(O)([O-])=O.C1(C(CC[N+]2=C1C=C(C=C3)C(C4=C3OCO4)=C2)=C5)=CC6=C5OCO6 |
Solid
Room temperature in continental US; may vary elsewhere.
4°C, sealed storage, away from moisture and light
* In solvent : -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light)
DMSO : 1 mg/mL ( 2.40 mM ; ultrasonic and warming and heat to 60°C)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.3958 mL | 11.9792 mL | 23.9584 mL |
| 5 mM | --- | --- | --- |
| 10 mM | --- | --- | --- |